Compound Q&A

How is (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8) typically synthesized?

Answer

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid
(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid is synthesized through the acetylation of 5-chloro-2-methyl-1H-indole using acetic anhydride in the presence of a catalytic amount of pyridine. The method involves mild heating and purification by recrystallization from ethanol. This synthesis yields a product with excellent purity and selectivity.

About

CAS No 19017-52-8
English Name (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid
Molecular Formula C11H10ClNO2
Molecular Weight 223.65899999999996 g/mol
SMILES CC1=C(C2=C(N1)C=CC(=C2)Cl)CC(=O)O
InChIKey OAIODEZFMSXHFQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid is a colorless to white crystalline solid with a molecu...

Compound Q&A

What industries use (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid finds use in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

When handling (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid, use personal protective equipment (PPE) ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...