Compound Q&A

What industries use Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Answer

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate
Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involving pyrimidine derivatives. It is also used in the polymer industry as a monomer and in the development of sensors due to its specific chemical properties.

About

English Name Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate
Molecular Formula C12H10N2O3
Molecular Weight 230.22 g/mol
SMILES COC(=O)c1cccc(c1)c2ncc(cn2)O
InChIKey HMOOJGNQBDDOPX-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is a crystalline compound with a mole...

Compound Q&A

How is Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) typically synthesized?

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is typically synthesized by the conde...

Compound Q&A

What precautions should be taken when handling Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Handling Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) requires the use of personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...