Compound Q&A

What are the physical and chemical properties of Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Answer

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate
Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is a crystalline compound with a molecular weight of approximately 268.24 g/mol. It has a pKa value of around 5.5 and is slightly soluble in water. This compound is known for its reactivity in nucleophilic substitution reactions and is used in various synthetic procedures. Its solubility in common organic solvents such as ethanol and acetone is moderate to good.

About

English Name Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate
Molecular Formula C12H10N2O3
Molecular Weight 230.22 g/mol
SMILES COC(=O)c1cccc(c1)c2ncc(cn2)O
InChIKey HMOOJGNQBDDOPX-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) typically synthesized?

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is typically synthesized by the conde...

Compound Q&A

What industries use Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0)?

Handling Methyl 3-(5-hydroxy-2-pyrimidinyl)benzoate (CAS: 1092568-87-0) requires the use of personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...