Compound Q&A

What precautions should be taken when handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Answer

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
When handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated environment or a fume hood. Spills should be cleaned up carefully using appropriate cleaning agents, and proper disposal methods should be followed as per the safety data sheet (SDS). Always refer to the SDS for detailed handling and emergency procedures.

About

English Name Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
Molecular Formula C15H6O6S3
Molecular Weight 378.41 g/mol
SMILES OC(=O)C1=CC2=C(S1)C1C=C(SC=1C1C=C(SC=12)C(O)=O)C(O)=O
InChIKey NZKKLAALKJGLDC-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is a crystalline solid with a hig...

Compound Q&A

How is Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6) typically synthesized?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is synthesized through a multi-st...

Compound Q&A

What industries use Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is used in the pharmaceutical, po...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...