Compound Q&A

What industries use Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Answer

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is used in the pharmaceutical, polymer, and electronics industries. It serves as a precursor for drug synthesis and is employed in the development of organic semiconductors and sensors due to its unique electronic properties. Its role in polymer chemistry is also explored for creating advanced materials with improved properties.

About

English Name Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
Molecular Formula C15H6O6S3
Molecular Weight 378.41 g/mol
SMILES OC(=O)C1=CC2=C(S1)C1C=C(SC=1C1C=C(SC=12)C(O)=O)C(O)=O
InChIKey NZKKLAALKJGLDC-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is a crystalline solid with a hig...

Compound Q&A

How is Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6) typically synthesized?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

When handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid, it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...