Compound Q&A

What are the physical and chemical properties of Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Answer

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is a crystalline solid with a high molecular weight. It has low solubility in water but is soluble in organic solvents. This compound is highly reactive due to its carboxylic acid groups, making it susceptible to acid-base reactions and esterification. It can form stable complexes with various metal ions, contributing to its potential applications in catalysis and sensor technology.

About

English Name Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid
Molecular Formula C15H6O6S3
Molecular Weight 378.41 g/mol
SMILES OC(=O)C1=CC2=C(S1)C1C=C(SC=1C1C=C(SC=12)C(O)=O)C(O)=O
InChIKey NZKKLAALKJGLDC-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6) typically synthesized?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is synthesized through a multi-st...

Compound Q&A

What industries use Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid is used in the pharmaceutical, po...

Compound Q&A

What precautions should be taken when handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid (CAS: 1174223-25-6)?

When handling Bisthieno[2,3-e:2',3'-g][1]benzothiophene-2,5,8-tricarboxylic acid, it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...