Compound Q&A

What industries use (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

Answer

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol
(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol is primarily used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It also finds applications in polymer chemistry, where it can be used as a monomer or cross-linking agent. Additionally, it has potential uses in sensor technology and semiconductor manufacturing due to its unique chemical properties.

About

CAS No 88374-37-2
English Name (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol
Molecular Formula C10H13N3O3
Molecular Weight 223.23 g/mol
SMILES C1CC(N(C1)C2=NC=C(C=C2)[N+](=O)[O-])CO
InChIKey YBARIBJRNJYVTK-VIFPVBQESA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2) typically synthesized?

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol can be synthesized through the condensation reaction of 5-nitr...

Compound Q&A

What precautions should be taken when handling (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

When handling (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...