Compound Q&A

How is (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2) typically synthesized?

Answer

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol
(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol can be synthesized through the condensation reaction of 5-nitropyridine and proline. The reaction is typically catalyzed by an appropriate base such as potassium carbonate or sodium hydride. The process involves the formation of an intermediate that is subsequently protonated to form the desired prolinol derivative. This method provides good yield and selectivity.

About

CAS No 88374-37-2
English Name (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol
Molecular Formula C10H13N3O3
Molecular Weight 223.23 g/mol
SMILES C1CC(N(C1)C2=NC=C(C=C2)[N+](=O)[O-])CO
InChIKey YBARIBJRNJYVTK-VIFPVBQESA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

(S)-(-)-N-(5-Nitro-2-pyridyl)prolinol is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol (CAS: 88374-37-2)?

When handling (S)-(-)-N-(5-Nitro-2-pyridyl)prolinol, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...