Compound Q&A

What precautions should be taken when handling 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

Answer

1-Carbobenzoxy-3-methylimidazolium Triflate
When handling 1-Carbobenzoxy-3-methylimidazolium Triflate, wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Ensure that the work is carried out in a well-ventilated area or a fume hood. Dispose of any contaminated materials according to local regulations. In case of a spill, immediately clean up using appropriate tools and materials. Always consult the safety data sheet (SDS) for detailed handling instructions.

About

English Name 1-Carbobenzoxy-3-methylimidazolium Triflate
Molecular Formula C13H13F3N2O5S
Molecular Weight 368.33 g/mol
SMILES C[N+]1=CN(C=C1)C(=O)OCC2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey ICFSDLPZJDDPHP-UHFFFAOYSA-M
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

1-Carbobenzoxy-3-methylimidazolium Triflate is a solid with a crystalline form. The molecular weight...

Compound Q&A

How is 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7) typically synthesized?

1-Carbobenzoxy-3-methylimidazolium Triflate is typically synthesized through the reaction of 1-carbo...

Compound Q&A

What industries use 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

1-Carbobenzoxy-3-methylimidazolium Triflate is used in various industries. It is particularly import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...