Compound Q&A

What are the physical and chemical properties of 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

Answer

1-Carbobenzoxy-3-methylimidazolium Triflate
1-Carbobenzoxy-3-methylimidazolium Triflate is a solid with a crystalline form. The molecular weight is approximately 295.2 g/mol. It has good solubility in organic solvents and poor solubility in water. It is moderately reactive, showing good stability under normal conditions but can degrade under acidic or basic conditions. This compound is known for its unique electrochemical properties, making it suitable for various applications.

About

English Name 1-Carbobenzoxy-3-methylimidazolium Triflate
Molecular Formula C13H13F3N2O5S
Molecular Weight 368.33 g/mol
SMILES C[N+]1=CN(C=C1)C(=O)OCC2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey ICFSDLPZJDDPHP-UHFFFAOYSA-M
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7) typically synthesized?

1-Carbobenzoxy-3-methylimidazolium Triflate is typically synthesized through the reaction of 1-carbo...

Compound Q&A

What industries use 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

1-Carbobenzoxy-3-methylimidazolium Triflate is used in various industries. It is particularly import...

Compound Q&A

What precautions should be taken when handling 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

When handling 1-Carbobenzoxy-3-methylimidazolium Triflate, wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...