Compound Q&A

What industries use 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

Answer

1-Carbobenzoxy-3-methylimidazolium Triflate
1-Carbobenzoxy-3-methylimidazolium Triflate is used in various industries. It is particularly important in the pharmaceutical sector for its role in organic synthesis and as a proton conductor. It is also used in the polymer industry for modifying the properties of polymers. Additionally, it is utilized in sensor technology and semiconductor manufacturing due to its excellent electrochemical properties.

About

English Name 1-Carbobenzoxy-3-methylimidazolium Triflate
Molecular Formula C13H13F3N2O5S
Molecular Weight 368.33 g/mol
SMILES C[N+]1=CN(C=C1)C(=O)OCC2=CC=CC=C2.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey ICFSDLPZJDDPHP-UHFFFAOYSA-M
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

1-Carbobenzoxy-3-methylimidazolium Triflate is a solid with a crystalline form. The molecular weight...

Compound Q&A

How is 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7) typically synthesized?

1-Carbobenzoxy-3-methylimidazolium Triflate is typically synthesized through the reaction of 1-carbo...

Compound Q&A

What precautions should be taken when handling 1-Carbobenzoxy-3-methylimidazolium Triflate (CAS: 163080-99-7)?

When handling 1-Carbobenzoxy-3-methylimidazolium Triflate, wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...