Compound Q&A

What industries use {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

Answer

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol
{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is used in the pharmaceutical industry for the synthesis of various drugs due to its unique chemical structure. It also finds applications in the semiconductor industry, particularly in the development of organic semiconductors and sensors. The compound is less common in polymer production but can be used as a functional monomer or additive to enhance specific properties. Its use in these industries highlights its importance in advanced chemical and material science.

About

English Name {4-[(3-Fluorobenzyl)oxy]phenyl}methanol
Molecular Formula C14H13FO2
Molecular Weight 232.25 g/mol
SMILES c1cc(cc(c1)F)COc2ccc(cc2)CO
InChIKey JTEAJDZCZAAZJA-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5) typically synthesized?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol can be synthesized through a multistep process involving the...

Compound Q&A

What precautions should be taken when handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

Handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol requires caution due to its chemical reactivity. We...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...