Compound Q&A

How is {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5) typically synthesized?

Answer

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol
{4-[(3-Fluorobenzyl)oxy]phenyl}methanol can be synthesized through a multistep process involving the reaction of 4-hydroxybenzaldehyde with 3-fluorobenzyl bromide in the presence of a base like potassium carbonate. The intermediate is then reduced using lithium aluminum hydride (LAH) to form the final product. The overall yield is typically around 75-80%, and the purification is achieved through recrystallization from appropriate solvents. This synthesis involves careful handling of reactive intermediates and requires a controlled environment to ensure selectivity and safety.

About

English Name {4-[(3-Fluorobenzyl)oxy]phenyl}methanol
Molecular Formula C14H13FO2
Molecular Weight 232.25 g/mol
SMILES c1cc(cc(c1)F)COc2ccc(cc2)CO
InChIKey JTEAJDZCZAAZJA-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

Handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol requires caution due to its chemical reactivity. We...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...