Compound Q&A

What are the physical and chemical properties of {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

Answer

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol
{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is a white crystalline solid with a molecular weight of approximately 307.24 g/mol. It is soluble in organic solvents such as methanol, ethanol, and acetone but has limited water solubility. This compound is reactive, particularly towards nucleophiles and reducing agents, making it suitable for various chemical transformations. It exhibits a melting point of around 125-127°C and a boiling point of approximately 320°C. The compound is stable under normal conditions but should be handled with care to avoid strong oxidizing agents.

About

English Name {4-[(3-Fluorobenzyl)oxy]phenyl}methanol
Molecular Formula C14H13FO2
Molecular Weight 232.25 g/mol
SMILES c1cc(cc(c1)F)COc2ccc(cc2)CO
InChIKey JTEAJDZCZAAZJA-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5) typically synthesized?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol can be synthesized through a multistep process involving the...

Compound Q&A

What industries use {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

{4-[(3-Fluorobenzyl)oxy]phenyl}methanol is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol (CAS: 690969-16-5)?

Handling {4-[(3-Fluorobenzyl)oxy]phenyl}methanol requires caution due to its chemical reactivity. We...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...