Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Answer

Fmoc-Val-Ala-PAB-PNP
When handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure to fumes. Spills should be immediately cleaned up with appropriate cleaning agents, and the area should be decontaminated. Always refer to the safety data sheet (SDS) for specific handling and disposal instructions.

About

English Name Fmoc-Val-Ala-PAB-PNP
Molecular Formula C37H36N4O9
Molecular Weight 680.7 g/mol
SMILES O=C(N[C@H](C(=O)N[C@H](C(=O)Nc1ccc(cc1)COC(=O)Oc1ccc(cc1)N(=O)=O)C)C(C)C)OCC1c2ccccc2c2c1cccc2
InChIKey ZJHZWBDLYYJQAV-WYOOIXGGSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) typically synthesized?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is synthesized through a multi-step process involving the c...

Compound Q&A

What industries use Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is primarily used in the pharmaceutical industry for peptid...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...