Compound Q&A

How is Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) typically synthesized?

Answer

Fmoc-Val-Ala-PAB-PNP
Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is synthesized through a multi-step process involving the coupling of Fmoc-Val-Ala-OH with PAB-PNP using standard peptide coupling reagents like HATU or DCC in the presence of a base such as DIPEA. The reaction typically proceeds with high yield and selectivity, making it a reliable method for preparing this compound.

About

English Name Fmoc-Val-Ala-PAB-PNP
Molecular Formula C37H36N4O9
Molecular Weight 680.7 g/mol
SMILES O=C(N[C@H](C(=O)N[C@H](C(=O)Nc1ccc(cc1)COC(=O)Oc1ccc(cc1)N(=O)=O)C)C(C)C)OCC1c2ccccc2c2c1cccc2
InChIKey ZJHZWBDLYYJQAV-WYOOIXGGSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is primarily used in the pharmaceutical industry for peptid...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

When handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...