Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Answer

Fmoc-Val-Ala-PAB-PNP
Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is a crystalline solid with a molecular weight of approximately 470.48 g/mol. It has a high solubility in polar solvents such as DMSO and methanol. This compound is reactive towards standard coupling reagents and is commonly used in peptide synthesis. It exhibits low reactivity towards common nucleophiles and is stable under standard synthetic conditions.

About

English Name Fmoc-Val-Ala-PAB-PNP
Molecular Formula C37H36N4O9
Molecular Weight 680.7 g/mol
SMILES O=C(N[C@H](C(=O)N[C@H](C(=O)Nc1ccc(cc1)COC(=O)Oc1ccc(cc1)N(=O)=O)C)C(C)C)OCC1c2ccccc2c2c1cccc2
InChIKey ZJHZWBDLYYJQAV-WYOOIXGGSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) typically synthesized?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is synthesized through a multi-step process involving the c...

Compound Q&A

What industries use Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6) is primarily used in the pharmaceutical industry for peptid...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6)?

When handling Fmoc-Val-Ala-PAB-PNP (CAS: 1394238-92-6), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...