Compound Q&A

What industries use Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Answer

Ethyl 5-quinolinecarboxylate
Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is used in various industries, particularly in the pharmaceutical sector for the synthesis of certain drugs. It is also used in the formulation of organic sensors and can be found in some polymers and semiconductor applications due to its unique chemical properties.

About

CAS No 98421-25-1
English Name Ethyl 5-quinolinecarboxylate
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES CCOC(=O)C1=C2C=CC=NC2=CC=C1
InChIKey ZNPJEEKRBNYZQQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is a crystalline compound with a molecular weight of ...

Compound Q&A

How is Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) typically synthesized?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is typically synthesized by the esterification reacti...

Compound Q&A

What precautions should be taken when handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

When handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...