Compound Q&A

What are the physical and chemical properties of Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Answer

Ethyl 5-quinolinecarboxylate
Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is a crystalline compound with a molecular weight of approximately 230.26 g/mol. It has a high solubility in organic solvents such as methanol and ethanol. This compound exhibits moderate reactivity, primarily undergoing ester hydrolysis under alkaline conditions. It is stable under normal conditions but should be stored away from strong acids and bases to prevent degradation.

About

CAS No 98421-25-1
English Name Ethyl 5-quinolinecarboxylate
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES CCOC(=O)C1=C2C=CC=NC2=CC=C1
InChIKey ZNPJEEKRBNYZQQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) typically synthesized?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is typically synthesized by the esterification reacti...

Compound Q&A

What industries use Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is used in various industries, particularly in the ph...

Compound Q&A

What precautions should be taken when handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

When handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...