Compound Q&A

How is Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) typically synthesized?

Answer

Ethyl 5-quinolinecarboxylate
Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is typically synthesized by the esterification reaction of 5-quinolinesulfonic acid with ethanol. The reaction can be catalyzed by a strong acid such as sulfuric acid. The yield is generally good, and the product can be isolated by simple organic chemistry techniques such as crystallization and filtration.

About

CAS No 98421-25-1
English Name Ethyl 5-quinolinecarboxylate
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES CCOC(=O)C1=C2C=CC=NC2=CC=C1
InChIKey ZNPJEEKRBNYZQQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1) is used in various industries, particularly in the ph...

Compound Q&A

What precautions should be taken when handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1)?

When handling Ethyl 5-quinolinecarboxylate (CAS: 98421-25-1), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...