Compound Q&A

How is Ly-2334737 (CAS: 892128-60-8) typically synthesized?

Answer

Ly-2334737
Ly-2334737 is synthesized through a multi-step organic reaction involving the coupling of an aryl halide with an aldehyde under the presence of a palladium catalyst. The reaction requires careful temperature control and the use of anhydrous conditions to achieve high yield and selectivity. Catalysts such as Pd(PPh3)4 are commonly used.

About

English Name Ly-2334737
Molecular Formula C17H25F2N3O5
Molecular Weight 389.4 g/mol
SMILES CCCC(CCC)C(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)CO)O)(F)F
InChIKey MEOYFIHNRBNEPI-UXIGCNINSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ly-2334737 (CAS: 892128-60-8)?

Ly-2334737 is a crystalline compound with a molecular weight of approximately 590.54 g/mol. It has a...

Compound Q&A

What industries use Ly-2334737 (CAS: 892128-60-8)?

Ly-2334737 is primarily used in the pharmaceutical industry for the development of novel drugs. It i...

Compound Q&A

What precautions should be taken when handling Ly-2334737 (CAS: 892128-60-8)?

When handling Ly-2334737, it is crucial to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...