Compound Q&A

What are the physical and chemical properties of Ly-2334737 (CAS: 892128-60-8)?

Answer

Ly-2334737
Ly-2334737 is a crystalline compound with a molecular weight of approximately 590.54 g/mol. It has a poor aqueous solubility but is soluble in organic solvents like dimethyl sulfoxide (DMSO). Ly-2334737 is relatively stable under normal conditions but may react with strong acids or bases. It is typically stored in a sealed container to prevent moisture uptake.

About

English Name Ly-2334737
Molecular Formula C17H25F2N3O5
Molecular Weight 389.4 g/mol
SMILES CCCC(CCC)C(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)CO)O)(F)F
InChIKey MEOYFIHNRBNEPI-UXIGCNINSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Ly-2334737 (CAS: 892128-60-8) typically synthesized?

Ly-2334737 is synthesized through a multi-step organic reaction involving the coupling of an aryl ha...

Compound Q&A

What industries use Ly-2334737 (CAS: 892128-60-8)?

Ly-2334737 is primarily used in the pharmaceutical industry for the development of novel drugs. It i...

Compound Q&A

What precautions should be taken when handling Ly-2334737 (CAS: 892128-60-8)?

When handling Ly-2334737, it is crucial to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...