Compound Q&A

What are the physical and chemical properties of Quinoline-4-carbothioamide (CAS: 74585-98-1)?

Answer

Quinoline-4-carbothioamide
Quinoline-4-carbothioamide is a solid with a crystalline form and a molecular weight of approximately 228.24 g/mol. It is slightly soluble in water but more soluble in organic solvents like DMSO. Chemically, it is relatively stable but can react with strong acids or bases. Its reactivity is moderate and it is not prone to spontaneous decomposition under normal storage conditions.

About

CAS No 74585-98-1
English Name Quinoline-4-carbothioamide
Molecular Formula C10H8N2S
Molecular Weight 188.26 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=N2)C(=S)N
InChIKey CVBYCKKBOIJRTK-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Quinoline-4-carbothioamide (CAS: 74585-98-1) typically synthesized?

Quinoline-4-carbothioamide is typically synthesized via a multistep process that includes the prepar...

Compound Q&A

What industries use Quinoline-4-carbothioamide (CAS: 74585-98-1)?

Quinoline-4-carbothioamide is used in the pharmaceutical industry for its potential as an antifungal...

Compound Q&A

What precautions should be taken when handling Quinoline-4-carbothioamide (CAS: 74585-98-1)?

When handling Quinoline-4-carbothioamide, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...