Compound Q&A

What precautions should be taken when handling (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

Answer

(S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine
When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Safety data sheets (SDS) should be consulted for specific handling and disposal instructions.

About

English Name (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine
Molecular Formula C34H32FeO2P2
Molecular Weight 590.41 g/mol
SMILES [CH]1[CH][CH][CH][CH]1.C[C@@H]([C]1[CH][CH][CH][C]1P(c1ccco1)c1ccco1)P(c1ccccc1C)c1ccccc1C.[Fe]
InChIKey SPAUEXSFJREZBQ-IFUPQEAVSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

This compound is a chiral phosphine ligand. It has a crystalline form with a molecular weight of app...

Compound Q&A

How is (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9) typically synthesized?

This compound is typically synthesized using a multistep process involving the preparation of ferroc...

Compound Q&A

What industries use (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

This compound is primarily used in the pharmaceutical and polymer industries for its catalytic prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...