Compound Q&A

What industries use (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

Answer

(S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine
This compound is primarily used in the pharmaceutical and polymer industries for its catalytic properties. It is particularly useful in the synthesis of chiral molecules and in the preparation of polymers with specific properties. It also finds application in sensors and semiconductors due to its electronic and optical properties.

About

English Name (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine
Molecular Formula C34H32FeO2P2
Molecular Weight 590.41 g/mol
SMILES [CH]1[CH][CH][CH][CH]1.C[C@@H]([C]1[CH][CH][CH][C]1P(c1ccco1)c1ccco1)P(c1ccccc1C)c1ccccc1C.[Fe]
InChIKey SPAUEXSFJREZBQ-IFUPQEAVSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

This compound is a chiral phosphine ligand. It has a crystalline form with a molecular weight of app...

Compound Q&A

How is (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9) typically synthesized?

This compound is typically synthesized using a multistep process involving the preparation of ferroc...

Compound Q&A

What precautions should be taken when handling (S)-1-{(RP)-2-[Di(2-furyl)phosphino]ferrocenyl}ethylbis(2-methylphenyl)phosphine (CAS: 849924-74-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...