Compound Q&A

How should Magnoloside B (CAS: 116872-05-0) be stored?

Answer

Magnoloside B
Magnoloside B (CAS: 116872-05-0) should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation.

About

English Name Magnoloside B
Molecular Formula C35H46O20
Molecular Weight 786.7 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(C(OC2OCCC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)O)O)O)O
InChIKey MGCIVWNKCIWQHX-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Magnoloside B (CAS: 116872-05-0)?

Magnoloside B (CAS: 116872-05-0) is a triterpenoid saponin isolated from the Magnolia species. It ex...

Compound Q&A

What are the main uses of Magnoloside B (CAS: 116872-05-0)?

Magnoloside B (CAS: 116872-05-0) is used in pharmaceutical applications for its anti-inflammatory an...

Compound Q&A

Is Magnoloside B (CAS: 116872-05-0) safe?

Magnoloside B (CAS: 116872-05-0) is considered safe for use in cosmetic and pharmaceutical products ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...