Compound Q&A

What are the main uses of Magnoloside B (CAS: 116872-05-0)?

Answer

Magnoloside B
Magnoloside B (CAS: 116872-05-0) is used in pharmaceutical applications for its anti-inflammatory and antioxidant effects, as well as in cosmetics for its skin care benefits. It is also studied for its potential in cancer research.

About

English Name Magnoloside B
Molecular Formula C35H46O20
Molecular Weight 786.7 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(C(OC2OCCC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)O)O)O)O
InChIKey MGCIVWNKCIWQHX-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Magnoloside B (CAS: 116872-05-0)?

Magnoloside B (CAS: 116872-05-0) is a triterpenoid saponin isolated from the Magnolia species. It ex...

Compound Q&A

Is Magnoloside B (CAS: 116872-05-0) safe?

Magnoloside B (CAS: 116872-05-0) is considered safe for use in cosmetic and pharmaceutical products ...

Compound Q&A

How should Magnoloside B (CAS: 116872-05-0) be stored?

Magnoloside B (CAS: 116872-05-0) should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...