Compound Q&A

Is Magnoloside B (CAS: 116872-05-0) safe?

Answer

Magnoloside B
Magnoloside B (CAS: 116872-05-0) is considered safe for use in cosmetic and pharmaceutical products with proper handling. However, it is advisable to follow safety guidelines and avoid contact with eyes and open wounds.

About

English Name Magnoloside B
Molecular Formula C35H46O20
Molecular Weight 786.7 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(C(OC2OCCC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)O)O)O)O
InChIKey MGCIVWNKCIWQHX-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Magnoloside B (CAS: 116872-05-0)?

Magnoloside B (CAS: 116872-05-0) is a triterpenoid saponin isolated from the Magnolia species. It ex...

Compound Q&A

What are the main uses of Magnoloside B (CAS: 116872-05-0)?

Magnoloside B (CAS: 116872-05-0) is used in pharmaceutical applications for its anti-inflammatory an...

Compound Q&A

How should Magnoloside B (CAS: 116872-05-0) be stored?

Magnoloside B (CAS: 116872-05-0) should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...