Compound Q&A

What industries use Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Answer

Ethyl 2,6-dichloro-5-fluoronicotinate
Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is primarily used in the pharmaceutical industry for the synthesis of certain intermediates and active pharmaceutical ingredients. It is also explored in the polymer industry for the development of novel materials and in sensor technology for specific chemical detection applications.

About

CAS No 82671-03-2
English Name Ethyl 2,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.05 g/mol
SMILES CCOC(=O)C1=CC(F)=C(Cl)N=C1Cl
InChIKey FPPLCOWQBGOFDU-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is a crystalline solid with a molecular weig...

Compound Q&A

How is Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) typically synthesized?

Ethyl 2,6-dichloro-5-fluoronicotinate can be synthesized through a multi-step process involving the ...

Compound Q&A

What precautions should be taken when handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

When handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...