Compound Q&A

How is Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) typically synthesized?

Answer

Ethyl 2,6-dichloro-5-fluoronicotinate
Ethyl 2,6-dichloro-5-fluoronicotinate can be synthesized through a multi-step process involving the first chlorination of nicotinic acid, followed by the selective alkylation with ethylmagnesium bromide. This method provides good yield and selectivity. Catalysts such as aluminum chloride are often used to enhance reactivity and control the reaction pathway.

About

CAS No 82671-03-2
English Name Ethyl 2,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.05 g/mol
SMILES CCOC(=O)C1=CC(F)=C(Cl)N=C1Cl
InChIKey FPPLCOWQBGOFDU-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

When handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...