Compound Q&A

What are the physical and chemical properties of Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Answer

Ethyl 2,6-dichloro-5-fluoronicotinate
Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is a crystalline solid with a molecular weight of approximately 318.03 g/mol. It has limited water solubility and is soluble in common organic solvents like ethanol and acetone. The compound exhibits moderate reactivity towards nucleophiles and can be used in various synthetic transformations. It is stable under normal storage conditions but should be handled with care due to its potential for hydrolysis under basic conditions.

About

CAS No 82671-03-2
English Name Ethyl 2,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.05 g/mol
SMILES CCOC(=O)C1=CC(F)=C(Cl)N=C1Cl
InChIKey FPPLCOWQBGOFDU-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) typically synthesized?

Ethyl 2,6-dichloro-5-fluoronicotinate can be synthesized through a multi-step process involving the ...

Compound Q&A

What industries use Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2)?

When handling Ethyl 2,6-dichloro-5-fluoronicotinate (CAS: 82671-03-2), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...