Compound Q&A

What industries use N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea] (CAS: 743458-79-9)?

Answer

N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea
This compound is primarily used in the pharmaceutical industry for its therapeutic properties and in the development of new drugs. It is also utilized in the sensor and semiconductor industries due to its unique chemical and physical properties, such as electronic conductivity. Additionally, it is used in polymer research for its potential to modify polymer properties.

About

English Name N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea
Molecular Formula C24H20F12N4S2
Molecular Weight 656.56 g/mol
SMILES S=C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)N[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F
InChIKey VALSAKIMMYEMHC-QZTJIDSGSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea] (CAS: 743458-79-9)?

The compound is a white crystalline solid with a high molecular weight. It has low solubility in wat...

Compound Q&A

How is N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea] (CAS: 743458-79-9) typically synthesized?

This compound is synthesized via a multi-step process involving the coupling of thiourea derivatives...

Compound Q&A

What precautions should be taken when handling N,N'-(1R,2R)-1,2-Cyclohexanediylbis[N'-[3,5-bis(trifluoromethyl)phenyl]thiourea] (CAS: 743458-79-9)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...