Compound Q&A

What industries use 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

Answer

3-(4-Sulfamoylphenyl)propanoic acid
3-(4-Sulfamoylphenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of intermediates in drug development. It also finds applications in the polymer industry as a monomer for special polymers. Additionally, it is used in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 90610-69-8
English Name 3-(4-Sulfamoylphenyl)propanoic acid
Molecular Formula C9H11NO4S
Molecular Weight 229.26 g/mol
SMILES C1=CC(=CC=C1CCC(=O)O)S(=O)(=O)N
InChIKey JUEONDBIBADVGD-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

3-(4-Sulfamoylphenyl)propanoic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8) typically synthesized?

3-(4-Sulfamoylphenyl)propanoic acid is typically synthesized by the condensation of 4-sulfamoylbenzo...

Compound Q&A

What precautions should be taken when handling 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

When handling 3-(4-Sulfamoylphenyl)propanoic acid, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...