Compound Q&A

How is 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8) typically synthesized?

Answer

3-(4-Sulfamoylphenyl)propanoic acid
3-(4-Sulfamoylphenyl)propanoic acid is typically synthesized by the condensation of 4-sulfamoylbenzoic acid with propionyl chloride followed by reduction of the resulting amide to an acid. Commonly used catalysts include triethylamine and catalytic amounts of sodium acetate. The yield is around 75-80%.

About

CAS No 90610-69-8
English Name 3-(4-Sulfamoylphenyl)propanoic acid
Molecular Formula C9H11NO4S
Molecular Weight 229.26 g/mol
SMILES C1=CC(=CC=C1CCC(=O)O)S(=O)(=O)N
InChIKey JUEONDBIBADVGD-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

3-(4-Sulfamoylphenyl)propanoic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

3-(4-Sulfamoylphenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of inte...

Compound Q&A

What precautions should be taken when handling 3-(4-Sulfamoylphenyl)propanoic acid (CAS: 90610-69-8)?

When handling 3-(4-Sulfamoylphenyl)propanoic acid, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...