Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

Answer

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
When handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate, it is crucial to use appropriate personal protective equipment (PPE) such as gloves and safety goggles. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it should be handled in a well-ventilated area, and the spill should be cleaned up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
Molecular Formula C13H21NO3
Molecular Weight 239.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CCC2=O)CC1
InChIKey IJUALTPNDJIBJT-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is a white crystalline powder. Its mol...

Compound Q&A

How is 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7) typically synthesized?

2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is typically synthesized via a multi-st...

Compound Q&A

What industries use 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate finds application in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...