Compound Q&A

How is 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7) typically synthesized?

Answer

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is typically synthesized via a multi-step process involving the condensation of a protected azaspiro compound with a carboxylic acid derivative. The reaction is catalyzed by a Lewis acid like boron trifluoride or a mild acid such as acetic acid. The method ensures high yield and good selectivity, making it suitable for industrial-scale production.

About

English Name 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
Molecular Formula C13H21NO3
Molecular Weight 239.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CCC2=O)CC1
InChIKey IJUALTPNDJIBJT-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is a white crystalline powder. Its mol...

Compound Q&A

What industries use 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate finds application in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

When handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate, it is crucial to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...