Compound Q&A

What industries use 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

Answer

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate finds application in the pharmaceutical industry for synthesizing complex natural products and drug intermediates. It is also used in the polymer industry for the development of functional polymers. In addition, it is explored for use in sensors and semiconductor manufacturing due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate
Molecular Formula C13H21NO3
Molecular Weight 239.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CCC2=O)CC1
InChIKey IJUALTPNDJIBJT-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

2-Methyl-2-propanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is a white crystalline powder. Its mol...

Compound Q&A

How is 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7) typically synthesized?

2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate is typically synthesized via a multi-st...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CAS: 849203-60-7)?

When handling 2-Methyl-2-proanyl 1-oxo-7-azaspiro[3.5]nonane-7-carboxylate, it is crucial to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...