Compound Q&A

What industries use 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (CAS: 1375108-46-5)?

Answer

7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline finds applications in the pharmaceutical industry for the development of new drugs due to its specific chemical structure. It is also used in the polymer industry for the synthesis of novel materials. Additionally, this compound plays a role in the fabrication of sensors and semiconductors, where its unique properties make it suitable for electronic and optical applications.

About

English Name 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline
Molecular Formula C14H17BN2O2
Molecular Weight 256.11400000000003 g/mol
SMILES B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC=NC=C3C=C2
InChIKey RJXJTNJULNSBLM-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (CAS: 1375108-46-5)?

7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline is a crystalline compound with a molecula...

Compound Q&A

How is 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (CAS: 1375108-46-5) typically synthesized?

7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline is usually synthesized via a palladium-ca...

Compound Q&A

What precautions should be taken when handling 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (CAS: 1375108-46-5)?

When handling 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline, it is crucial to wear appr...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...