Compound Q&A

What industries use Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

Answer

Diethyl (4-cyanobenzyl)phosphonate
Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6) is primarily used in the pharmaceutical industry for the synthesis of certain drug candidates. It also finds applications in the polymer industry for the development of advanced materials. Additionally, it is used in the electronics industry for the fabrication of semiconductors and in the chemical industry for various organic synthesis processes.

About

CAS No 1552-41-6
English Name Diethyl (4-cyanobenzyl)phosphonate
Molecular Formula C12H16NO3P
Molecular Weight 253.23 g/mol
SMILES CCOP(=O)(CC1=CC=C(C=C1)C#N)OCC
InChIKey MFXWOYIWKNJHPC-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

Diethyl (4-cyanobenzyl)phosphonate is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6) typically synthesized?

Diethyl (4-cyanobenzyl)phosphonate is typically synthesized via a multistep process. A common route ...

Compound Q&A

What precautions should be taken when handling Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

When handling Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6), it is essential to follow strict ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...