Compound Q&A

What are the physical and chemical properties of Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

Answer

Diethyl (4-cyanobenzyl)phosphonate
Diethyl (4-cyanobenzyl)phosphonate is a crystalline compound with a molecular weight of approximately 234.24 g/mol. It has a high solubility in organic solvents like methanol and acetone but is sparingly soluble in water. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It is often used as an intermediate in organic synthesis due to its ability to participate in various chemical transformations.

About

CAS No 1552-41-6
English Name Diethyl (4-cyanobenzyl)phosphonate
Molecular Formula C12H16NO3P
Molecular Weight 253.23 g/mol
SMILES CCOP(=O)(CC1=CC=C(C=C1)C#N)OCC
InChIKey MFXWOYIWKNJHPC-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6) typically synthesized?

Diethyl (4-cyanobenzyl)phosphonate is typically synthesized via a multistep process. A common route ...

Compound Q&A

What industries use Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6)?

When handling Diethyl (4-cyanobenzyl)phosphonate (CAS: 1552-41-6), it is essential to follow strict ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...