Compound Q&A

What industries use Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Answer

Methyl 2,4,6-trimethylbenzoate
Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is used in various industries. It is a common compound in the fragrance and flavor industry due to its pleasant odor. It is also used in the pharmaceutical industry as a solvent and in the production of some drugs. Additionally, it is utilized in the polymer industry as a plasticizer and in the synthesis of certain materials. Furthermore, it finds applications in the sensor and semiconductor industries as a component in some chemical sensors and as a precursor for organic semiconductors.

About

CAS No 2282-84-0
English Name Methyl 2,4,6-trimethylbenzoate
Molecular Formula C11H14O2
Molecular Weight 178.231 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)OC)C
InChIKey PXLABDTXHJPRRH-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is a colorless to light yellow liquid with a pungent...

Compound Q&A

How is Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) typically synthesized?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is typically synthesized via the esterification of 2...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

When handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0), it is essential to follow standard la...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...