Compound Q&A

How is Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) typically synthesized?

Answer

Methyl 2,4,6-trimethylbenzoate
Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is typically synthesized via the esterification of 2,4,6-trimethylbenzoic acid with methanol in the presence of a strong acid catalyst, such as sulfuric acid. The reaction is carried out under reflux conditions, and the product is then purified by distillation. The yield is generally around 85-90%, and the reaction proceeds with high selectivity to form the desired product.

About

CAS No 2282-84-0
English Name Methyl 2,4,6-trimethylbenzoate
Molecular Formula C11H14O2
Molecular Weight 178.23 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)OC)C
InChIKey PXLABDTXHJPRRH-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is a colorless to light yellow liquid with a pungent...

Compound Q&A

What industries use Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is used in various industries. It is a common compou...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

When handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0), it is essential to follow standard la...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...