Compound Q&A

What are the physical and chemical properties of Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Answer

Methyl 2,4,6-trimethylbenzoate
Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is a colorless to light yellow liquid with a pungent odor. It has a melting point of approximately -27°C, a boiling point of 251-252°C, and a molecular weight of around 202.25 g/mol. This compound is soluble in ethanol, acetone, and chloroform but is only slightly soluble in water. It is relatively stable under normal conditions but can react with strong acids or bases to form trimethylbenzoates or other derivatives.

About

CAS No 2282-84-0
English Name Methyl 2,4,6-trimethylbenzoate
Molecular Formula C11H14O2
Molecular Weight 178.231 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)OC)C
InChIKey PXLABDTXHJPRRH-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) typically synthesized?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is typically synthesized via the esterification of 2...

Compound Q&A

What industries use Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0) is used in various industries. It is a common compou...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0)?

When handling Methyl 2,4,6-trimethylbenzoate (CAS: 2282-84-0), it is essential to follow standard la...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...