Compound Q&A

What industries use Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Answer

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is used in the pharmaceutical industry for the synthesis of certain intermediates and in the development of new drugs. It is also utilized in the production of various sensors, where its reactivity and specificity are advantageous. Additionally, it finds applications in the synthesis of materials for semiconductors and as a reagent in organic chemistry research.

About

CAS No 91983-31-2
English Name Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Molecular Formula C8H6BrNO5
Molecular Weight 276.0409 g/mol
SMILES COC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])O
InChIKey YGVJGAVKLPOPMS-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is a crystalline solid with a molecular w...

Compound Q&A

How is Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) typically synthesized?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate is typically synthesized via the nitration of methyl 5-brom...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

When handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2), it is crucial to wear appr...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...