Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Answer

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is a crystalline solid with a molecular weight of approximately 322.04 g/mol. It has a solubility of about 0.15 g/L in water and is slightly soluble in common organic solvents. This compound is highly reactive, particularly towards nucleophiles and reducing agents. It is sensitive to light and air, leading to degradation and discoloration.

About

CAS No 91983-31-2
English Name Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Molecular Formula C8H6BrNO5
Molecular Weight 276.0409 g/mol
SMILES COC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])O
InChIKey YGVJGAVKLPOPMS-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) typically synthesized?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate is typically synthesized via the nitration of methyl 5-brom...

Compound Q&A

What industries use Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

When handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2), it is crucial to wear appr...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...