Compound Q&A

How is Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) typically synthesized?

Answer

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Methyl 5-bromo-2-hydroxy-3-nitrobenzoate is typically synthesized via the nitration of methyl 5-bromo-2-hydroxybenzoate in the presence of concentrated sulfuric acid as a catalyst. The reaction is carried out at a temperature around 50°C. The yield is generally around 70-80%, and the product is purified by recrystallization from ethanol.

About

CAS No 91983-31-2
English Name Methyl 5-bromo-2-hydroxy-3-nitrobenzoate
Molecular Formula C8H6BrNO5
Molecular Weight 276.0409 g/mol
SMILES COC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])O
InChIKey YGVJGAVKLPOPMS-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is a crystalline solid with a molecular w...

Compound Q&A

What industries use Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2)?

When handling Methyl 5-bromo-2-hydroxy-3-nitrobenzoate (CAS: 91983-31-2), it is crucial to wear appr...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...