Compound Q&A

How is 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0) typically synthesized?

Answer

4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid
This compound can be synthesized via a multistep process involving the condensation of an amino benzyl derivative with a chloro pyrimidine carboxylic acid followed by an alkylation step. The synthesis typically uses sodium hydride as a base and dimethyl sulfate as the alkylating agent. The yield is moderate, and the procedure involves careful handling of amines and haloarenes to ensure high purity and selectivity.

About

English Name 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid
Molecular Formula C14H14ClN3O3S
Molecular Weight 339.8 g/mol
SMILES COC1=C(C=C(C=C1)CNC2=NC(=NC=C2C(=O)O)SC)Cl
InChIKey PXYYGISXAWKTCT-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid is a white crystallin...

Compound Q&A

What industries use 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

This compound has potential applications in the pharmaceutical industry as an intermediate in the sy...

Compound Q&A

What precautions should be taken when handling 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

Handling this compound requires appropriate Personal Protective Equipment (PPE), including gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...