Compound Q&A

What are the physical and chemical properties of 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

Answer

4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid
4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid is a white crystalline solid at room temperature. Its molecular weight is approximately 414.13 g/mol. It is slightly soluble in water and more soluble in organic solvents. Chemically, it is an amine derivative of a pyrimidine carboxylic acid, which makes it reactive towards nucleophilic substitution reactions and condensation reactions.

About

English Name 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid
Molecular Formula C14H14ClN3O3S
Molecular Weight 339.8 g/mol
SMILES COC1=C(C=C(C=C1)CNC2=NC(=NC=C2C(=O)O)SC)Cl
InChIKey PXYYGISXAWKTCT-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0) typically synthesized?

This compound can be synthesized via a multistep process involving the condensation of an amino benz...

Compound Q&A

What industries use 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

This compound has potential applications in the pharmaceutical industry as an intermediate in the sy...

Compound Q&A

What precautions should be taken when handling 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid (CAS: 330786-34-0)?

Handling this compound requires appropriate Personal Protective Equipment (PPE), including gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...