Compound Q&A

How is 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4) typically synthesized?

Answer

3-Formyl-4-methoxybenzoic acid
3-Formyl-4-methoxybenzoic acid can be synthesized by the oxidation of 4-methoxybenzyl alcohol using peroxyacids like peroxybenzoic acid. Alternatively, it can be prepared by formylation of 4-methoxybenzoic acid using formyl chloride and a base such as sodium hydride. The reaction typically provides high yields and good selectivity.

About

CAS No 91420-99-4
English Name 3-Formyl-4-methoxybenzoic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)O)C=O
InChIKey LAQPQIRPQCMEHG-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

3-Formyl-4-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 212.2...

Compound Q&A

What industries use 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

3-Formyl-4-methoxybenzoic acid finds applications in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

When handling 3-Formyl-4-methoxybenzoic acid, proper personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...