Compound Q&A

What are the physical and chemical properties of 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

Answer

3-Formyl-4-methoxybenzoic acid
3-Formyl-4-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 212.21 g/mol. It has a pKa of around 3.2 and is slightly soluble in water. This compound is reactive, particularly towards nucleophilic attack on the formyl group and the carboxylic acid functionality. It exhibits good solubility in organic solvents such as methanol and ethanol.

About

CAS No 91420-99-4
English Name 3-Formyl-4-methoxybenzoic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)O)C=O
InChIKey LAQPQIRPQCMEHG-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4) typically synthesized?

3-Formyl-4-methoxybenzoic acid can be synthesized by the oxidation of 4-methoxybenzyl alcohol using ...

Compound Q&A

What industries use 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

3-Formyl-4-methoxybenzoic acid finds applications in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 3-Formyl-4-methoxybenzoic acid (CAS: 91420-99-4)?

When handling 3-Formyl-4-methoxybenzoic acid, proper personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...